CAS 69537-64-0
:tyr-D-ala-gly
Description:
Tyr-D-Ala-Gly, also known as Tyr-D-Alanine-Glycine, is a synthetic peptide that consists of the amino acids tyrosine (Tyr), D-alanine (D-Ala), and glycine (Gly). This compound is characterized by its specific sequence of amino acids, which influences its biological activity and interactions. The presence of D-alanine, a non-natural amino acid, can impart unique properties, such as increased resistance to enzymatic degradation, making it of interest in pharmaceutical and biochemical research. Tyr-D-Ala-Gly may exhibit various biological activities, including potential roles in modulating neurotransmitter systems or serving as a model for studying peptide interactions. Its CAS number, 69537-64-0, is a unique identifier that facilitates the tracking and referencing of this compound in scientific literature and databases. As with many peptides, its solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature, which are important considerations in experimental applications.
Formula:C14H19N3O5
InChI:InChI=1/C14H19N3O5/c1-8(13(21)16-7-12(19)20)17-14(22)11(15)6-9-2-4-10(18)5-3-9/h2-5,8,11,18H,6-7,15H2,1H3,(H,16,21)(H,17,22)(H,19,20)/t8-,11+/m1/s1
Synonyms:- H-Tyr-D-Ala-Gly-OH
- L-tyrosyl-D-alanylglycine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
H-Tyr-D-Ala-Gly-OH
CAS:<p>H-Tyr-D-Ala-Gly-OH is a chemical compound that is used in the field of molecular biology. It is an amino acid which has been modified to contain a terminal amine group, so it can be coupled to other molecules through a covalent bond. H-Tyr-D-Ala-Gly-OH can be used as a diagnostic marker for mouse monoclonal antibodies. The antibody reacts with the H-Tyr-D-Ala-Gly-OH by binding to its peptide receptors, which are located on the cell surface and inside the cells. This receptor activity can be detected using immunohistochemistry or flow cytometry. Immunohistochemical detection of H-Tyr-D-Ala-Gly--OH is useful for diagnosing cancer, such as breast cancer, where it can be found in high levels in metastatic lesions.</p>Formula:C14H19N3O5Purity:Min. 95%Molecular weight:309.32 g/mol
