CAS 6954-50-3
:2-isonicotinoyl-N-phenylhydrazinecarbothioamide
Description:
2-Isonicotinoyl-N-phenylhydrazinecarbothioamide is a chemical compound characterized by its unique structural features, which include an isonicotinoyl group and a phenylhydrazine moiety. This compound typically exhibits properties associated with thioamide functionalities, such as potential reactivity in nucleophilic substitution reactions. It may display biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the isonicotinoyl group suggests potential interactions with biological targets, possibly influencing its pharmacological profile. Additionally, the compound may exhibit solubility in organic solvents, which is common for similar thioamide derivatives. Its molecular structure allows for various functional group transformations, making it a versatile intermediate in organic synthesis. As with many chemical substances, safety and handling precautions should be observed due to potential toxicity or reactivity. Overall, 2-isonicotinoyl-N-phenylhydrazinecarbothioamide represents a compound of interest for further research in both synthetic and medicinal chemistry contexts.
Formula:C13H12N4OS
InChI:InChI=1/C13H12N4OS/c18-12(10-6-8-14-9-7-10)16-17-13(19)15-11-4-2-1-3-5-11/h1-9H,(H,16,18)(H2,15,17,19)
SMILES:c1ccc(cc1)N=C(NN=C(c1ccncc1)O)S
Synonyms:- 1-Phenyl-4-isonicotinoylthiosemicarbazide
- N-phenyl-2-(pyridin-4-ylcarbonyl)hydrazinecarbothioamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
