CAS 69558-55-0
:thymopentin
Description:
Thymopentin is a synthetic peptide that consists of five amino acids, specifically derived from the thymic hormone thymosin. It is known for its immunomodulatory properties, which means it can influence the immune system's response. Thymopentin is often studied for its potential therapeutic applications, particularly in enhancing immune function and as an adjunct in various medical conditions, including immunodeficiency and certain cancers. The peptide is characterized by its ability to stimulate T-cell proliferation and enhance the activity of natural killer cells, making it of interest in immunotherapy research. In terms of physical properties, thymopentin is typically a white to off-white powder that is soluble in water, facilitating its use in various formulations. Its mechanism of action involves binding to specific receptors on immune cells, thereby promoting cellular communication and activity. As with any peptide, stability and storage conditions are crucial for maintaining its efficacy, and it is generally recommended to be stored in a cool, dry place, protected from light.
Formula:C30H49N9O9
InChI:InChI=1/C30H49N9O9/c1-16(2)24(28(46)38-22(29(47)48)14-17-8-10-18(40)11-9-17)39-27(45)21(15-23(41)42)37-26(44)20(7-3-4-12-31)36-25(43)19(32)6-5-13-35-30(33)34/h8-11,16,19-22,24,40H,3-7,12-15,31-32H2,1-2H3,(H,36,43)(H,37,44)(H,38,46)(H,39,45)(H,41,42)(H,47,48)(H4,33,34,35)/t19-,20-,21-,22-,24-/m0/s1
SMILES:CC(C)[C@@H](C(=N[C@@H](Cc1ccc(cc1)O)C(=O)O)O)N=C([C@H](CC(=O)O)N=C([C@H](CCCCN)N=C([C@H](CCCNC(=N)N)N)O)O)O
Synonyms:- Immunox
- Sintomodulina
- Thymopoietin 32-36
- Thymopoietin pentapeptide
- Thymopoietin pentapeptide-Fluorescin-isothiocyanate
- Timunox
- Tp-5
- N~5~-(diaminomethylidene)ornithyllysyl-alpha-aspartylvalyltyrosine
- N~5~-(diaminomethylidene)-L-ornithyl-L-lysyl-L-alpha-aspartyl-L-valyl-L-tyrosine
- thymopentin (TP-5)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Thymopentin, 99+%
CAS:Reduces endocrine responses
Formula:C30H49N9O9Purity:99+%Color and Shape:White, Lyophilized powderMolecular weight:679.78L-Tyrosine, L-arginyl-L-lysyl-L-a-aspartyl-L-valyl-
CAS:Formula:C30H49N9O9Purity:95%Color and Shape:SolidMolecular weight:679.7650Thymopentin
CAS:Formula:C30H49N9O9Purity:>90.0%(HPLC)(qNMR)Color and Shape:White to Light yellow powder to crystalMolecular weight:679.78Thymopentin
CAS:Formula:C30H49N9O9Purity:95%~99%Color and Shape:White to Off-white PowderMolecular weight:679.765Thymopentin
CAS:Thymopentin (TP5), a synthetic peptide of amino acids 32-36 of thymopoietin, is an active immunomodulator studied for rheumatoid arthritis and AIDS.
Formula:C30H49N9O9Purity:99.35% - 99.94%Color and Shape:WhiteMolecular weight:679.77





