CAS 6956-82-7
:(4-bromo-2-methylphenoxy)acetic acid
Description:
(4-bromo-2-methylphenoxy)acetic acid, with the CAS number 6956-82-7, is an organic compound that belongs to the class of phenoxyacetic acids. It features a phenoxy group, which is a phenyl ether, substituted with a bromine atom at the para position and a methyl group at the ortho position relative to the ether linkage. This compound is typically characterized by its moderate solubility in organic solvents and limited solubility in water, reflecting its hydrophobic nature due to the aromatic structure. It exhibits acidic properties due to the carboxylic acid functional group, allowing it to participate in various chemical reactions, including esterification and neutralization. The presence of the bromine atom can influence its reactivity and biological activity, making it of interest in various fields, including pharmaceuticals and agrochemicals. Additionally, its structural features may impart specific biological activities, which can be explored in research contexts. Safety and handling precautions should be observed, as with many chemical substances, to mitigate any potential hazards.
Formula:C9H9BrO3
InChI:InChI=1/C9H9BrO3/c1-6-4-7(10)2-3-8(6)13-5-9(11)12/h2-4H,5H2,1H3,(H,11,12)
SMILES:Cc1cc(ccc1OCC(=O)O)Br
Synonyms:- Acetic Acid, 2-(4-Bromo-2-Methylphenoxy)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2-(4-Bromo-2-methylphenoxy)acetic acid
CAS:<p>2-(4-Bromo-2-methylphenoxy)acetic acid is a sulfonated phenolic compound that is synthesized by the sulfurylation of 2-methylphenoxyacetic acid with sulfuryl chloride. It has been used as a chemical intermediate in the synthesis of various drugs, such as triethanolamine. 2-(4-Bromo-2-methylphenoxy)acetic acid can also be used to produce fluorinated compounds, such as pentafluoropropionic and hexafluoroacetic acids. The chlorination reaction is an efficient method for the production of this compound.</p>Formula:C9H9BrO3Purity:Min. 95%Molecular weight:245.08 g/mol
