CymitQuimica logo

CAS 69570-39-4

:

S-[(2S)-3-Chloro-2-methyl-3-oxopropyl] ethanethioate

Description:
S-[(2S)-3-Chloro-2-methyl-3-oxopropyl] ethanethioate, with the CAS number 69570-39-4, is a chemical compound characterized by its specific stereochemistry and functional groups. It features a thioate ester functional group, which is indicative of its potential reactivity in various chemical reactions, particularly in nucleophilic substitutions. The presence of a chloro group and a ketone moiety contributes to its reactivity and may influence its biological activity. This compound is likely to be a chiral molecule, given the presence of a stereogenic center, which can lead to different biological effects depending on its enantiomeric form. Its structure suggests potential applications in organic synthesis or as an intermediate in the production of more complex molecules. Additionally, the thioate group may impart specific properties such as increased lipophilicity or altered solubility in various solvents. As with many chemical substances, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C6H9ClO2S
InChI:InChI=1S/C6H9ClO2S/c1-4(6(7)9)3-10-5(2)8/h4H,3H2,1-2H3/t4-/m0/s1
InChI key:InChIKey=LUDPWTHDXSOXDX-BYPYZUCNSA-N
SMILES:[C@H](CSC(C)=O)(C(Cl)=O)C
Synonyms:
  • (2S)-3-(Acetylsulfanyl)-2-methylpropanoyl chloride
  • (2S)-3-Acetylthio-2-methylpropionyl chloride
  • <span class="text-smallcaps">D</span>-3-(Acetylthio)-2-methylpropanoyl chloride
  • Ethanethioic acid, S-(3-chloro-2-methyl-3-oxopropyl) ester, (S)-
  • Ethanethioic acid, S-[(2S)-3-chloro-2-methyl-3-oxopropyl] ester
  • S-[(2S)-3-chloro-2-methyl-3-oxopropyl] ethanethioate
  • D-3-(Acetylthio)-2-methylpropanoyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.