CAS 69570-82-7

(4S)-2-(4-fluorophenyl)thiazolidine-4-carboxylic acid

Description:

(4S)-2-(4-fluorophenyl)thiazolidine-4-carboxylic acid is a chemical compound characterized by its thiazolidine ring structure, which incorporates a sulfur atom and a carboxylic acid functional group. The presence of the 4-fluorophenyl group indicates that there is a fluorine atom substituted on a phenyl ring, which can influence the compound's reactivity and biological activity. This compound is typically classified as an amino acid derivative due to the presence of both an amine and a carboxylic acid functional group. Its stereochemistry is defined by the (4S) configuration, indicating that it has a specific three-dimensional arrangement that can affect its interactions in biological systems. The compound may exhibit properties such as solubility in polar solvents and potential biological activity, making it of interest in medicinal chemistry and drug development. Its CAS number, 69570-82-7, allows for easy identification in chemical databases and literature. Overall, this compound's unique structure and functional groups contribute to its potential applications in various fields, including pharmaceuticals and biochemistry.

Formula: C₁₀H₁₀FNO₂S

InChI: InChI=1/C10H10FNO2S/c11-7-3-1-6(2-4-7)9-12-8(5-15-9)10(13)14/h1-4,8-9,12H,5H2,(H,13,14)/t8-,9?/m1/s1

SMILES: c1cc(ccc1C1N[C@H](CS1)C(=O)O)F

Synonyms:

• 2-(4-Fluoro-phenyl)-thiazolidine-4-
• Carboxylic Acid

2-(4-Fluoro-phenyl)-thiazolidine-4-carboxylic acid

CAS: 69570-82-7

Formula: C₁₀H₁₀FNO₂S

Purity: 95.0%

Molecular weight: 227.25

Ref: 10-F027710