CAS 69578-21-8

(4S)-2-(4-dimethylaminophenyl)thiazolidine-4-carboxylic acid

Description:

(4S)-2-(4-dimethylaminophenyl)thiazolidine-4-carboxylic acid, with CAS number 69578-21-8, is a thiazolidine derivative characterized by a thiazolidine ring structure that incorporates a carboxylic acid functional group and a dimethylaminophenyl substituent. This compound typically exhibits properties associated with thiazolidines, such as potential biological activity, including anti-inflammatory and antidiabetic effects, due to its structural features. The presence of the dimethylamino group may enhance its lipophilicity and influence its interaction with biological targets. The stereochemistry indicated by the (4S) configuration suggests specific spatial arrangements that can affect the compound's reactivity and biological activity. Additionally, the carboxylic acid group contributes to its acidity and potential for forming salts or esters. Overall, this compound's unique structure may lead to diverse applications in medicinal chemistry and pharmacology, although specific biological activities and mechanisms would require further investigation.

Formula: C₁₂H₁₆N₂O₂S

InChI: InChI=1/C12H16N2O2S/c1-14(2)9-5-3-8(4-6-9)11-13-10(7-17-11)12(15)16/h3-6,10-11,13H,7H2,1-2H3,(H,15,16)/t10-,11?/m1/s1

SMILES: CN(C)c1ccc(cc1)C1N[C@H](CS1)C(=O)O

Synonyms:

• 2-(4-Dimethylamino-phenyl)-thiazolidine-4-
• Carboxylic Acid

2-(4-(Dimethylamino)phenyl)-1,3-thiazolidine-4-carboxylic acid

CAS: 69578-21-8

Please enquire for more information about 2-(4-(Dimethylamino)phenyl)-1,3-thiazolidine-4-carboxylic acid including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₂H₁₆N₂O₂S

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 252.33 g/mol

Ref: 3D-FD168910