CAS 69579-74-4
:Methanone,(3-hydroxy-2-furanyl)phenyl-
Description:
Methanone, (3-hydroxy-2-furanyl)phenyl- is an organic compound characterized by its unique structure, which includes a phenyl group and a furan moiety. The presence of the methanone functional group indicates that it is a ketone, specifically a derivative of acetophenone. The compound features a hydroxyl group (-OH) at the 3-position of the furan ring, which can influence its reactivity and solubility. This hydroxyl group may also participate in hydrogen bonding, enhancing its potential interactions in various chemical environments. The furan ring contributes to the compound's aromaticity and stability, while the phenyl group adds to its overall hydrophobic character. Methanone, (3-hydroxy-2-furanyl)phenyl- may exhibit biological activity, making it of interest in pharmaceutical research. Its properties, such as melting point, boiling point, and solubility, would depend on the specific molecular interactions and the presence of functional groups. Overall, this compound exemplifies the complexity and diversity of organic chemistry, particularly in the realm of heterocyclic compounds.
Formula:C11H8O3
InChI:InChI=1/C11H8O3/c12-9-6-7-14-11(9)10(13)8-4-2-1-3-5-8/h1-7,13H/b11-10+
Synonyms:- Adustin
- Methanone,(3-hydroxy-2-furanyl)phenyl-
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Adustin
CAS:Adustin is an antifungal antibiotic characterized as a polypeptide that inhibits translation. It effectively suppresses translation in a cell-free rabbit reticulocyte lysate system, exhibiting an IC50 of 0.34 μM.Formula:C11H8O3Color and Shape:SolidMolecular weight:188.179
