CAS 6958-94-7
:4-(4-phenoxyphenyl)butanoic acid
Description:
4-(4-Phenoxyphenyl)butanoic acid, with the CAS number 6958-94-7, is an organic compound characterized by its aromatic structure and carboxylic acid functional group. It features a butanoic acid backbone attached to a phenoxyphenyl group, which contributes to its unique chemical properties. This compound is typically a white to off-white solid at room temperature and is sparingly soluble in water, but more soluble in organic solvents such as ethanol and acetone. Its molecular structure allows for potential applications in pharmaceuticals, particularly in the development of anti-inflammatory or analgesic agents, due to its ability to interact with biological systems. The presence of the phenoxy group may enhance its lipophilicity, influencing its bioavailability and pharmacokinetics. Additionally, the compound may exhibit interesting thermal and chemical stability, making it suitable for various synthetic applications. As with many organic acids, it can participate in acid-base reactions and may form salts or esters under appropriate conditions. Safety data should be consulted for handling and usage, as with all chemical substances.
Formula:C16H16O3
InChI:InChI=1/C16H16O3/c17-16(18)8-4-5-13-9-11-15(12-10-13)19-14-6-2-1-3-7-14/h1-3,6-7,9-12H,4-5,8H2,(H,17,18)
SMILES:c1ccc(cc1)Oc1ccc(CCCC(=O)O)cc1
Synonyms:- Benzenebutanoic Acid, 4-Phenoxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
4-(4-Phenoxyphenyl)butyric acid
CAS:4-(4-Phenoxyphenyl)butyric acid is a versatile building block that can be used in the synthesis of many different compounds. It has been used as a reaction component or intermediate in the synthesis of pharmaceuticals and agrochemicals, such as atorvastatin and methyltetrahydrofolate. 4-(4-Phenoxyphenyl)butyric acid is also used as a research chemical and has been shown to have antibacterial properties. This compound is soluble in water, making it easy to use in reactions with other reagents. 4-(4-Phenoxyphenyl)butyric acid is an important building block for many organic syntheses because it can be converted into a wide variety of useful compounds.Formula:C16H16O3Purity:Min. 95%Color and Shape:PowderMolecular weight:256.3 g/mol
