CAS 696-74-2

(1R,2S)-cyclopropane-1,2-dicarboxylic acid

Description:

(1R,2S)-cyclopropane-1,2-dicarboxylic acid, also known as cis-cyclopropane-1,2-dicarboxylic acid, is a bicyclic organic compound characterized by its unique cyclopropane ring structure, which consists of three carbon atoms forming a triangle. This compound features two carboxylic acid functional groups (-COOH) attached to the first and second carbon atoms of the cyclopropane ring, contributing to its acidic properties. The stereochemistry indicated by (1R,2S) denotes the specific spatial arrangement of the substituents around the chiral centers, which can influence its reactivity and interactions with biological systems. This compound is typically a white crystalline solid at room temperature and is soluble in polar solvents due to the presence of the carboxylic acid groups. It is of interest in organic synthesis and may serve as a building block for more complex molecules. Additionally, its unique structure can impart interesting properties, making it a subject of study in various fields, including medicinal chemistry and materials science.

Formula: C₅H₆O₄

InChI: InChI=1/C5H6O4/c6-4(7)2-1-3(2)5(8)9/h2-3H,1H2,(H,6,7)(H,8,9)/t2-,3+

Synonyms:

• 1,2-cyclopropanedicarboxylic acid, (1R,2S)-
• (1R,2S)-Cyclopropane-1,2-dicarboxylic acid

cis-1,2-Cyclopropane dicarboxylic acid

CAS: 696-74-2

Formula: C₅H₆O₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 130.0987

Ref: IN-DA00FGAS

(1R,2S)-rel-Cyclopropane-1,2-dicarboxylic acid

CAS: 696-74-2

(1R,2S)-rel-Cyclopropane-1,2-dicarboxylic acid

Purity: 97%

Molecular weight: 130.1g/mol

Ref: 54-OR1006816

(1R,2S)-rel-Cyclopropane-1,2-dicarboxylic acid

CAS: 696-74-2

Purity: 97%

Molecular weight: 130.099

Ref: 10-F985058

(1R,2S)-rel-Cyclopropane-1,2-dicarboxylic acid

CAS: 696-74-2

Formula: C₅H₆O₄

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 130.099

Ref: 10-F237911

(1R,2S)rel-cyclopropane1,2dicarboxylic acid

CAS: 696-74-2

(1R,2S)rel-cyclopropane1,2dicarboxylic acid is a synthetic compound. It has been shown to activate the camp-dependent protein kinase C and inhibit the phosphodiesterase type 3 enzyme. It also has gametocide properties in vitro assays. (1R,2S)rel-cyclopropane1,2dicarboxylic acid has been analysed using nmr spectra and transition state theory to determine its structure. The pharmacophore of (1R,2S)rel-cyclopropane1,2dicarboxylic acid is a dione with an activating hydrogen atom on one side and a hydrogenolysis site on the other.

Formula: C₅H₆O₄

Purity: Min. 95%

Molecular weight: 130.1 g/mol

Ref: 3D-AAA69674