CAS 696-83-3

6-fluoropyrimidine-2,4-diamine

Description:

6-Fluoropyrimidine-2,4-diamine, with the CAS number 696-83-3, is a heterocyclic organic compound characterized by a pyrimidine ring substituted with fluorine and amino groups. This compound features a fluorine atom at the 6-position and amino groups at the 2 and 4 positions of the pyrimidine ring, which contributes to its reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit properties such as solubility in polar solvents, depending on the specific conditions. The presence of the amino groups allows for hydrogen bonding, which can influence its interactions in biological systems. 6-Fluoropyrimidine-2,4-diamine is of interest in medicinal chemistry, particularly in the development of pharmaceuticals, as pyrimidine derivatives often play a role in nucleic acid metabolism and can act as antimetabolites. Its fluorine substitution may enhance lipophilicity and metabolic stability, making it a valuable compound for further research and application in drug design.

Formula: C₄H₅FN₄

InChI: InChI=1/C4H5FN4/c5-2-1-3(6)9-4(7)8-2/h1H,(H4,6,7,8,9)

SMILES: c1c(F)[nH]c(=N)[nH]c1=N

Synonyms:

• 2,4-Pyrimidinediamine, 6-Fluoro-

6-Fluoropyrimidine-2,4-diamine

CAS: 696-83-3

Formula: C₄H₅FN₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 128.1077

Ref: IN-DA005J69

6-Fluoropyrimidine-2,4-diamine

CAS: 696-83-3

6-Fluoropyrimidine-2,4-diamine

Purity: 95%

Molecular weight: 128.11g/mol

Ref: 54-PC110641

6-Fluoropyrimidine-2,4-diamine

CAS: 696-83-3

Formula: C₄H₅FN₄

Purity: 95%

Color and Shape: No data available.

Molecular weight: 128.11

Ref: 10-F411962