CAS 6960-39-0

methyl 3,4-O-(1-methylethylidene)pentopyranoside

Description:

Methyl 3,4-O-(1-methylethylidene)pentopyranoside, with the CAS number 6960-39-0, is a glycoside characterized by its sugar moiety and specific functional groups. This compound features a pentopyranoside structure, which indicates it is derived from a five-membered pyranose ring, typically associated with sugars. The presence of the methylethylidene group suggests that it has a branched structure, which can influence its reactivity and interactions with other molecules. Glycosides like this one often exhibit solubility in polar solvents due to their hydroxyl groups, and they may participate in various chemical reactions, including hydrolysis and glycosylation. The methyl group attached to the sugar enhances its stability and can affect its biological activity. Such compounds are of interest in fields like medicinal chemistry and biochemistry, where they may serve as intermediates or active agents in the synthesis of more complex molecules. Overall, the unique structural features of methyl 3,4-O-(1-methylethylidene)pentopyranoside contribute to its potential applications in research and industry.

Formula: C₉H₁₆O₅

InChI: InChI=1/C9H16O5/c1-9(2)13-5-4-12-8(11-3)6(10)7(5)14-9/h5-8,10H,4H2,1-3H3

SMILES: CC1(C)OC2COC(C(C2O1)O)OC

Methyl 3,4-isopropylidene-b-L-arabinopyranoside

CAS: 6960-39-0

Ref: 7W-GC7279

Methyl 3,4-Isopropylidene-β-L-arabinopyranoside

Controlled Product

CAS: 6960-39-0

Applications Patulin intermediate.
References Tsuda, Y., et al.: Chem. Pharm. Bull., 38, 1983 (1991), Akagi, M., et al.: Chem. Pharm. Bull., 50, 866 (2002),

Formula: C₉H₁₆O₅

Color and Shape: Neat

Molecular weight: 204.22

Ref: TR-M314530

Methyl 3,4-Isopropylidene-β-L-arabinopyranoside-13C

Controlled Product

CAS: 6960-39-0

Formula: C₈CH₁₆O₅

Color and Shape: Neat

Molecular weight: 205.21

Ref: TR-M314532

Methyl 3,4-isopropylidene-b-L-arabinopyranoside

CAS: 6960-39-0

Methyl 3,4-isopropylidene-b-L-arabinopyranoside is a synthetic saccharide that has been modified by the Click chemistry. Click modification is a method of modifying a complex carbohydrate with a reactive group (e.g., an azide) at one end of the molecule and an electrophile at the other end of the molecule. The resulting product can be used in glycosylation reactions to form complex carbohydrates with various properties. Methyl 3,4-isopropylidene-b-L-arabinopyranoside is used as a precursor for the synthesis of oligosaccharides and polysaccharides. It also has been shown to be effective as an inhibitor of bacterial growth in vitro by inhibiting protein synthesis.

Formula: C₉H₁₆O₅

Purity: Min. 95%

Molecular weight: 204.22 g/mol

Ref: 3D-MM16790