CAS 6962-54-5
:quinoxaline-2(1H)-thione
Description:
Quinoxaline-2(1H)-thione, identified by its CAS number 6962-54-5, is a heterocyclic compound featuring a quinoxaline core with a thione functional group. This compound exhibits a fused bicyclic structure, consisting of a benzene ring and a pyrazine ring, which contributes to its unique chemical properties. The presence of the thione group (–C=S) imparts distinct reactivity, allowing for potential applications in various chemical reactions, including nucleophilic substitutions and coordination chemistry. Quinoxaline derivatives are known for their biological activities, and this particular compound may exhibit antimicrobial or antitumor properties, although specific biological data may vary. It is typically a solid at room temperature and may be soluble in organic solvents. The compound's stability and reactivity can be influenced by substituents on the quinoxaline ring, making it a subject of interest in synthetic organic chemistry and medicinal chemistry research. Overall, quinoxaline-2(1H)-thione represents a versatile scaffold for further chemical exploration and potential applications in pharmaceuticals.
Formula:C8H6N2S
InChI:InChI=1/C8H6N2S/c11-8-5-9-6-3-1-2-4-7(6)10-8/h1-5H,(H,10,11)
SMILES:c1ccc2c(c1)ncc(=S)[nH]2
Synonyms:- 2,3-Quinoxalinethiol
- 2-Quinoxalinethiol
- Quinoxaline-2-thiol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Quinoxalinethiol
CAS:2-Quinoxalinethiol is an organic compound that belongs to the group of sulfa drugs. It is a reactive, low molecular weight chemical that reacts with carbaryl, a common pesticide, to form an inhibitor molecule. 2-Quinoxalinethiol has been shown to be a potent antimicrobial agent against bacteria and fungi. It also acts as a detergent additive for laundry detergent compositions. 2-Quinoxalinethiol can be used in model systems for studying the oxidation of sulfhydryl groups by hydrochloric acid or thiolate compounds.
Formula:C8H6N2SPurity:Min. 95%Molecular weight:162.21 g/mol
