CAS 6962-62-5
:(2E)-3-(1,3-benzodioxol-5-yl)-1-(2,4-dihydroxyphenyl)prop-2-en-1-one
Description:
The chemical substance known as (2E)-3-(1,3-benzodioxol-5-yl)-1-(2,4-dihydroxyphenyl)prop-2-en-1-one, with the CAS number 6962-62-5, is a synthetic organic compound characterized by its complex structure, which includes a benzodioxole moiety and a chalcone framework. This compound typically exhibits properties associated with flavonoids, including antioxidant and anti-inflammatory activities. Its structure features a conjugated system that can facilitate electron delocalization, contributing to its potential biological activities. The presence of hydroxyl groups enhances its solubility in polar solvents and may increase its reactivity with various biological targets. Additionally, the compound may exhibit UV-Vis absorbance characteristics typical of flavonoids, making it useful in photochemical applications. Its potential applications span across pharmaceuticals, where it may serve as a lead compound for drug development, particularly in the fields of cancer research and natural product chemistry. Overall, this compound represents a significant interest in medicinal chemistry due to its diverse biological activities and structural features.
Formula:C16H12O5
InChI:InChI=1/C16H12O5/c17-11-3-4-12(14(19)8-11)13(18)5-1-10-2-6-15-16(7-10)21-9-20-15/h1-8,17,19H,9H2/b5-1+
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
2',4'-Dihydroxy-3,4-methylenedioxychalcone
CAS:2',4'-Dihydroxy-3,4-methylenedioxychalcone is a fine chemical that is used as a versatile building block in organic synthesis. It can be used to synthesize a variety of complex compounds and has been used as a reaction component in the preparation of other useful chemicals. This compound has been found to be useful as an intermediate in organic synthesis and research chemicals. 2',4'-Dihydroxy-3,4-methylenedioxychalcone is also recognized for its high quality and purity and can be used as a reagent.Formula:C16H12O5Purity:Min. 95%Molecular weight:284.26 g/mol
