CymitQuimica logo

CAS 69622-42-0

:

2-tert-butyl-7-methyl-1H-indole

Description:
2-tert-butyl-7-methyl-1H-indole is an organic compound belonging to the indole family, characterized by its bicyclic structure that includes a fused benzene and pyrrole ring. This compound features a tert-butyl group at the 2-position and a methyl group at the 7-position of the indole ring, which contributes to its unique chemical properties. It is typically a solid at room temperature and may exhibit a range of physical properties such as solubility in organic solvents and varying melting and boiling points depending on the specific conditions. The presence of the bulky tert-butyl group can influence its steric hindrance and reactivity, making it of interest in various chemical syntheses and applications. Additionally, indole derivatives are known for their biological activity, and this compound may exhibit potential pharmacological properties. Its CAS number, 69622-42-0, allows for easy identification in chemical databases and literature. Overall, 2-tert-butyl-7-methyl-1H-indole is a notable compound in organic chemistry with implications in both synthetic and medicinal chemistry.
Formula:C13H17N
InChI:InChI=1/C13H17N/c1-9-6-5-7-10-8-11(13(2,3)4)14-12(9)10/h5-8,14H,1-4H3
SMILES:Cc1cccc2cc(C(C)(C)C)[nH]c12
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.