CAS 69625-13-4

2-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]acetonitrile

Description:

2-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]acetonitrile, with the CAS number 69625-13-4, is a chemical compound characterized by its thiazole and nitrile functional groups. This compound features a thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen, contributing to its biological activity and potential applications in pharmaceuticals. The presence of a nitrophenyl group enhances its electronic properties, making it useful in various chemical reactions and applications. Typically, compounds like this exhibit moderate to high solubility in organic solvents, while their solubility in water may vary. The nitrile group (-C≡N) is known for its reactivity, allowing for further derivatization. Additionally, the compound may exhibit interesting biological properties, including antimicrobial or anticancer activities, which are often explored in medicinal chemistry. Safety and handling precautions should be observed due to the potential toxicity associated with nitro compounds. Overall, this compound represents a valuable structure in synthetic organic chemistry and drug development.

Formula: C₁₁H₇N₃O₂S

InChI: InChI=1/C11H7N3O2S/c12-6-5-11-13-10(7-17-11)8-1-3-9(4-2-8)14(15)16/h1-4,7H,5H2

SMILES: c1cc(ccc1c1csc(CC#N)n1)N(=O)=O

Synonyms:

• [4-(4-Nitrophenyl)-1,3-Thiazol-2-Yl]Acetonitrile

2-[4-(4-Nitrophenyl)-1,3-thiazol-2-yl]acetonitrile

CAS: 69625-13-4

2-[4-(4-Nitrophenyl)-1,3-thiazol-2-yl]acetonitrile

Purity: 97%

Molecular weight: 245.26g/mol

Ref: 54-OR8141