CAS 69627-03-8
:7-Chlorothieno[3,2-b]pyridine
Description:
7-Chlorothieno[3,2-b]pyridine is a heterocyclic compound characterized by its fused thieno and pyridine rings, with a chlorine substituent at the 7-position of the thieno ring. This compound typically exhibits a pale yellow to brownish appearance and is soluble in organic solvents such as dimethyl sulfoxide (DMSO) and ethanol, but may have limited solubility in water. The presence of the chlorine atom introduces unique electronic properties, influencing its reactivity and potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The thieno[3,2-b]pyridine framework is known for its biological activity, making this compound of interest in drug discovery. Its molecular structure allows for various functionalization possibilities, which can enhance its pharmacological properties. Additionally, the compound's stability and reactivity can be influenced by the presence of the chlorine atom, which may participate in nucleophilic substitution reactions. Overall, 7-Chlorothieno[3,2-b]pyridine is a valuable compound in the field of organic synthesis and medicinal chemistry.
Formula:C7H4ClNS
InChI:InChI=1/C7H4ClNS/c8-5-1-3-9-6-2-4-10-7(5)6/h1-4H
SMILES:c1cnc2ccsc2c1Cl
Synonyms:- 7-Chlorthieno[3,2-b]pyridin
- Thieno[3,2-b]pyridine, 7-chloro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
7-Chlorothieno[3,2-b]pyridine
CAS:Formula:C7H4ClNSPurity:95%Color and Shape:SolidMolecular weight:169.63147-Chlorothieno[3,2-b]pyridine
CAS:7-Chlorothieno[3,2-b]pyridineFormula:C7H4ClNSPurity:97%Color and Shape: yellow solidMolecular weight:169.63136g/mol7-Chlorothieno[3,2-b]pyridine
CAS:Formula:C7H4ClNSPurity:>98.0%(GC)Color and Shape:White to Yellow to Orange powder to lumpMolecular weight:169.637-Chlorothieno[3,2-b]pyridine
CAS:Formula:C7H4ClNSPurity:95%Color and Shape:SolidMolecular weight:169.637-Chlorothieno[3,2-B]Pyridine
CAS:7-Chlorothieno[3,2-B]pyridine is a nucleophilic compound that is used as an inhibitor of the tyrosine kinase enzyme. It binds to the ATP binding site and blocks the enzymatic activity of the enzyme, preventing cell proliferation. 7-Chlorothieno[3,2-B]pyridine has been shown to inhibit growth in tumour cell lines and has been shown to be effective against tyrosine kinase receptor positive cancer cells. This drug also shows a cytotoxic activity against tumour cells in vivo, which may be due to its ability to inhibit factor receptor and receptor tyrosine.
Formula:C7H4ClNSPurity:Min. 95%Molecular weight:169.63 g/molRef: 3D-FC53344
Discontinued product




