CAS 6963-03-7
:6-nitro-4H-1,3-benzodioxine
Description:
6-Nitro-4H-1,3-benzodioxine is an organic compound characterized by its unique bicyclic structure, which consists of a benzene ring fused to a dioxine moiety. The presence of a nitro group at the 6-position of the benzodioxine framework contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and materials science. This compound is typically a pale yellow to brown solid, exhibiting moderate solubility in organic solvents. Its molecular structure imparts specific electronic properties, making it a candidate for use in organic synthesis and as an intermediate in the production of more complex molecules. Additionally, the nitro group can participate in electrophilic aromatic substitution reactions, enhancing its utility in synthetic chemistry. Safety data indicates that, like many nitro compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, 6-nitro-4H-1,3-benzodioxine is a valuable compound in the realm of organic chemistry, with diverse applications stemming from its distinctive structural features.
Formula:C8H7NO4
InChI:InChI=1/C8H7NO4/c10-9(11)7-1-2-8-6(3-7)4-12-5-13-8/h1-3H,4-5H2
SMILES:c1cc2c(cc1N(=O)=O)COCO2
Synonyms:- 4H-1,3-benzodioxin, 6-nitro-
- 6-Nitro-4H-benzo[d][1,3]dioxine
- 6-NITRO-4H-1,3-BENZODIOXINE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
6-Nitro-1,3-benzodioxane
CAS:Controlled ProductFormula:C8H7NO4Color and Shape:NeatMolecular weight:181.145
