CAS 6963-37-7
:N-(2-hydroxyphenyl)propanamide
Description:
N-(2-hydroxyphenyl)propanamide, also known as 2-hydroxy-N-propionylaniline, is an organic compound characterized by its amide functional group attached to a propanamide backbone and a 2-hydroxyphenyl moiety. This compound typically appears as a solid or crystalline substance and is soluble in organic solvents, with limited solubility in water due to its hydrophobic propanamide structure. The presence of the hydroxyl group on the aromatic ring contributes to its potential for hydrogen bonding, influencing its reactivity and interaction with other molecules. N-(2-hydroxyphenyl)propanamide may exhibit biological activity, making it of interest in pharmaceutical and chemical research. Its properties, such as melting point, boiling point, and spectral characteristics, can vary based on purity and environmental conditions. As with many organic compounds, safety precautions should be taken when handling this substance, as it may pose health risks if ingested or inhaled. Overall, N-(2-hydroxyphenyl)propanamide serves as a valuable compound in various chemical applications and research contexts.
Formula:C9H11NO2
InChI:InChI=1/C9H11NO2/c1-2-9(12)10-7-5-3-4-6-8(7)11/h3-6,11H,2H2,1H3,(H,10,12)
SMILES:CCC(=Nc1ccccc1O)O
Synonyms:- propanamide, N-(2-hydroxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N-(2-hydroxyphenyl)propanamide
CAS:Controlled ProductFormula:C9H11NO2Color and Shape:NeatMolecular weight:165.189
