CAS 6963-65-1

5-bromo-4-nitro-1H-imidazole

Description:

5-Bromo-4-nitro-1H-imidazole is a heterocyclic organic compound characterized by its imidazole ring, which is a five-membered ring containing two nitrogen atoms. The presence of a bromine atom at the 5-position and a nitro group at the 4-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit a yellowish color due to the nitro group. It is soluble in polar organic solvents, which can facilitate its use in various chemical reactions. The presence of both bromine and nitro groups makes it a potential candidate for further functionalization, allowing for the synthesis of more complex molecules. Additionally, 5-bromo-4-nitro-1H-imidazole can be utilized in medicinal chemistry and material science due to its biological activity and ability to form coordination complexes. As with many nitrogen-containing heterocycles, it may exhibit interesting electronic properties, making it valuable in the development of pharmaceuticals and agrochemicals. Safety precautions should be taken when handling this compound, as it may pose health risks.

Formula: C₃H₂BrN₃O₂

InChI: InChI=1/C3H2BrN3O2/c4-2-3(7(8)9)6-1-5-2/h1H,(H,5,6)

SMILES: c1nc(c([nH]1)N(=O)=O)Br

Synonyms:

• 1H-imidazole, 4-bromo-5-nitro-
• 1H-imidazole, 5-bromo-4-nitro-

5-Bromo-4-nitro-1H-imidazole

CAS: 6963-65-1

Formula: C₃H₂BrN₃O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 191.9709

Ref: IN-DA003KZ1

4-Bromo-5-nitro-1H-imidazole

CAS: 6963-65-1

4-Bromo-5-nitro-1H-imidazole

Purity: 95%

Color and Shape: Solid

Molecular weight: 191.97g/mol

Ref: 54-OR301330

5-Bromo-4-Nitro-1H-Imidazole

CAS: 6963-65-1

Formula: C₃H₂BrN₃O₂

Molecular weight: 191.97

Ref: 4Z-I-078036

5-Bromo-4-nitroimidazole

CAS: 6963-65-1

Formula: C₃H₂BrN₃O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 191.972

Ref: 10-F225223