CAS 6964-10-9
:5-Amino-4-phenyl-2(3H)-thiazolethione
Description:
5-Amino-4-phenyl-2(3H)-thiazolethione, with the CAS number 6964-10-9, is a heterocyclic compound characterized by the presence of both thiazole and thiol functional groups. This compound typically exhibits a yellow to orange crystalline appearance and is soluble in polar solvents. The thiazole ring contributes to its aromatic properties, while the amino group enhances its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Its structure allows for potential applications in pharmaceuticals, agrochemicals, and as a building block in organic synthesis. The compound may also exhibit biological activity, which can be explored for medicinal chemistry purposes. Additionally, its stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in practical applications. Overall, 5-Amino-4-phenyl-2(3H)-thiazolethione is a versatile compound with significant potential in various fields of chemistry and material science.
Formula:C9H8N2S2
InChI:InChI=1/C9H8N2S2/c10-8-7(11-9(12)13-8)6-4-2-1-3-5-6/h1-5H,10H2,(H,11,12)
InChI key:InChIKey=DFBLEVVSFACJOY-UHFFFAOYSA-N
SMILES:NC1=C(NC(=S)S1)C2=CC=CC=C2
Synonyms:- 2(3H)-Thiazolethione, 5-amino-4-phenyl-
- 2-Thiazolethiol, 5-amino-4-phenyl-
- 5-Amino-4-phenyl-2(3H)-thiazolethione
- 5-amino-4-phenyl-1,3-thiazole-2(3H)-thione
- NSC 66334
- 5-Amino-4-phenylthiazole-2(3H)-thione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.