CAS 69640-38-6

2,4-dichloro-6-(3,4,5-trichloro-1H-pyrrol-2-yl)phenol

Description:

2,4-Dichloro-6-(3,4,5-trichloro-1H-pyrrol-2-yl)phenol, with the CAS number 69640-38-6, is a synthetic organic compound characterized by its complex structure, which includes a phenolic ring substituted with dichloro and pyrrole moieties. This compound is notable for its chlorinated groups, which contribute to its chemical stability and potential biological activity. It is typically used in agricultural applications, particularly as a herbicide, due to its ability to inhibit specific biochemical pathways in plants. The presence of multiple chlorine atoms enhances its lipophilicity, allowing it to interact effectively with biological membranes. Additionally, the pyrrole ring may impart unique reactivity and interaction with various biological targets. As with many chlorinated compounds, it is essential to handle this substance with care, considering its potential environmental persistence and toxicity. Proper safety measures should be observed when working with this chemical, and its use is often regulated to mitigate ecological impact.

Formula: C₁₀H₄Cl₅NO

InChI: InChI=1/C10H4Cl5NO/c11-3-1-4(9(17)5(12)2-3)8-6(13)7(14)10(15)16-8/h1-2,16-17H

SMILES: c1c(cc(c(c1c1c(c(c(Cl)[nH]1)Cl)Cl)O)Cl)Cl

2,4-Dichloro-6-(3,4,5-trichloro-1H-pyrrol-2-yl)phenol

CAS: 69640-38-6

2,4-Dichloro-6-(3,4,5-trichloro-1H-pyrrol-2-yl)phenol

Purity: 98%

Molecular weight: 331.41g/mol

Ref: 54-OR1060655

Pentachloropseudilin

Controlled Product

CAS: 69640-38-6

Formula: C₁₀H₄Cl₅NO

Color and Shape: Neat

Molecular weight: 331.41

Ref: TR-P273410

Pentachloropseudilin

CAS: 69640-38-6

Pentachloropseudilin inhibits Myosin-1 and speeds up TGF-β receptor turnover, suppressing TGF-β activity.

Formula: C₁₀H₄Cl₅NO

Purity: 98.14%

Color and Shape: Solid

Molecular weight: 331.41

Ref: TM-T24612