CAS 6966-09-2

1-{[(1R)-2-oxocyclohexyl]methyl}piperidinium

Description:

1-{[(1R)-2-oxocyclohexyl]methyl}piperidinium, with the CAS number 6966-09-2, is a chemical compound characterized by its piperidinium structure, which includes a piperidine ring substituted with a cyclohexyl group that features a ketone functional group. This compound typically exhibits properties associated with quaternary ammonium salts, such as being a cationic species due to the positively charged nitrogen atom in the piperidinium moiety. The presence of the cyclohexyl group contributes to its hydrophobic characteristics, while the ketone functionality can participate in hydrogen bonding and may influence its solubility and reactivity. The stereochemistry indicated by the (1R) configuration suggests specific spatial arrangements that can affect the compound's biological activity and interactions. Overall, this compound may have applications in various fields, including medicinal chemistry and materials science, due to its unique structural features and potential reactivity.

Formula: C₁₂H₂₂NO

InChI: InChI=1/C12H21NO/c14-12-7-3-2-6-11(12)10-13-8-4-1-5-9-13/h11H,1-10H2/p+1/t11-/m1/s1

Pimeclone hydrochloride

CAS: 6966-09-2

Pimeclone hydrochloride is a psychostimulant or a respiratory stimulant drug.

Formula: C₁₂H₂₂ClNO

Purity: 98%

Color and Shape: Solid

Molecular weight: 231.76

Ref: TM-T24641