CymitQuimica logo

CAS 69660-39-5

:

2,6-Dihydroxy-1,4-benzenedicarboxylic acid

Description:
2,6-Dihydroxy-1,4-benzenedicarboxylic acid, also known as gentisic acid, is an organic compound characterized by its aromatic structure featuring two hydroxyl groups and two carboxylic acid groups. This compound is a derivative of benzenedicarboxylic acid, specifically with hydroxyl substitutions at the 2 and 6 positions of the benzene ring. It is typically a white to off-white crystalline solid that is soluble in water and polar organic solvents, reflecting its ability to form hydrogen bonds due to the presence of hydroxyl and carboxylic acid functional groups. The compound exhibits weak acidity, typical of carboxylic acids, and can participate in various chemical reactions, including esterification and oxidation. It is of interest in various fields, including biochemistry and materials science, due to its potential applications in pharmaceuticals and as a precursor for synthesizing other chemical compounds. Additionally, gentisic acid is known for its antioxidant properties, which may contribute to its biological significance.
Formula:C8H6O6
InChI:InChI=1S/C8H6O6/c9-4-1-3(7(11)12)2-5(10)6(4)8(13)14/h1-2,9-10H,(H,11,12)(H,13,14)
InChI key:InChIKey=YNIWBQWSPPNHRN-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(O)C=C(C(O)=O)C=C1O
Synonyms:
  • 2,6-Dihydroxy-1,4-benzenedicarboxylic acid
  • 1,4-Benzenedicarboxylic acid, 2,6-dihydroxy-
  • 2,6-Dihydroxyterephthalic acid
  • Terephthalic acid, 2,6-dihydroxy-
Found 4 products.