CymitQuimica logo

CAS 696612-04-1

:

3-Chloroquinolin-6-ol

Description:
3-Chloroquinolin-6-ol is a chemical compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of a chlorine atom at the 3-position and a hydroxyl group at the 6-position contributes to its unique properties. This compound typically appears as a solid and may exhibit a range of colors depending on its purity and form. It is known for its potential biological activities, including antimicrobial and antitumor properties, making it of interest in medicinal chemistry. The hydroxyl group can participate in hydrogen bonding, influencing its solubility and reactivity. Additionally, the chlorine substituent can affect the compound's electronic properties and reactivity, making it a useful building block in organic synthesis. As with many chemical substances, safety precautions should be observed when handling 3-Chloroquinolin-6-ol, as it may pose health risks if ingested or inhaled. Proper storage and disposal methods should be followed to minimize environmental impact.
Formula:C9H6ClNO
InChI:InChI=1S/C9H6ClNO/c10-7-3-6-4-8(12)1-2-9(6)11-5-7/h1-5,12H
InChI key:JZUCTMVWDCGGGG-UHFFFAOYSA-N
SMILES:C1=CC2=NC=C(C=C2C=C1O)Cl
Synonyms:
  • 3-Chloroquinolin-6-ol
  • 6-Quinolinol, 3-chloro-
Found 4 products.