CymitQuimica logo

CAS 6967-88-0

:

1-bromo-4-(propan-2-yloxy)benzene

Description:
1-Bromo-4-(propan-2-yloxy)benzene, also known by its CAS number 6967-88-0, is an organic compound characterized by the presence of a bromine atom and a propan-2-yloxy group attached to a benzene ring. This compound features a bromine substituent at the para position relative to the propan-2-yloxy group, which influences its reactivity and physical properties. It is typically a colorless to pale yellow liquid with a moderate boiling point and density, indicative of its aromatic structure. The presence of the ether functional group (propan-2-yloxy) contributes to its solubility in organic solvents while limiting its solubility in water. This compound can participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, making it useful in synthetic organic chemistry. Additionally, its bromine atom can serve as a leaving group in reactions, enhancing its utility in the synthesis of more complex organic molecules. Safety precautions should be observed when handling this compound due to its potential toxicity and reactivity.
Formula:C9H11BrO
InChI:InChI=1/C9H11BrO/c1-7(2)11-9-5-3-8(10)4-6-9/h3-7H,1-2H3
InChI key:MPAOOLLBWUEXOM-UHFFFAOYSA-N
SMILES:CC(C)Oc1ccc(cc1)Br
Synonyms:
  • 1-Bromo-4-isopropoxybenzene
  • 4-Bromophenyl isopropyl ether
  • 4-Bromophenyl Propan-2-Yl Ether
  • Benzene, 1-bromo-4-(1-methylethoxy)-
Found 3 products.