CymitQuimica logo

CAS 69672-40-8

:

(2S)-1-fluoro-3-(1H-imidazol-5-yl)propan-2-amine

Description:
(2S)-1-fluoro-3-(1H-imidazol-5-yl)propan-2-amine, with the CAS number 69672-40-8, is a chiral organic compound characterized by the presence of a fluorine atom and an imidazole ring. This compound features a propan-2-amine backbone, which contributes to its potential biological activity. The imidazole moiety is known for its role in various biological systems, often participating in enzyme catalysis and serving as a building block for many pharmaceuticals. The fluorine substitution can enhance the compound's lipophilicity and metabolic stability, making it of interest in medicinal chemistry. As a chiral molecule, it exists in two enantiomeric forms, with the (2S) configuration being the specific stereoisomer referenced. This stereochemistry can significantly influence the compound's pharmacological properties, including receptor binding and activity. Overall, (2S)-1-fluoro-3-(1H-imidazol-5-yl)propan-2-amine is a compound of interest for research in drug development and biochemistry, particularly in the context of its potential therapeutic applications.
Formula:C6H10FN3
InChI:InChI=1/C6H10FN3/c7-2-5(8)1-6-3-9-4-10-6/h3-5H,1-2,8H2,(H,9,10)/t5-/m0/s1
SMILES:C([C@@H](CF)N)c1cnc[nH]1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.