CymitQuimica logo

CAS 69675-98-5

:

(2-amino-5-methylphenyl)phosphonic acid

Description:
(2-amino-5-methylphenyl)phosphonic acid, with the CAS number 69675-98-5, is an organophosphorus compound characterized by the presence of a phosphonic acid functional group attached to a substituted aniline structure. This compound features an amino group and a methyl group on the aromatic ring, which contribute to its chemical reactivity and potential biological activity. It is typically a white to off-white solid that is soluble in water due to the presence of the phosphonic acid group, which can ionize in aqueous solutions. The compound is of interest in various fields, including agriculture and pharmaceuticals, due to its potential role as a herbicide or as a building block in the synthesis of more complex molecules. Its properties, such as stability, reactivity, and solubility, make it a subject of study in both synthetic and applied chemistry. Safety data should be consulted for handling and usage, as with all chemical substances.
Formula:C7H10NO3P
InChI:InChI=1/C7H10NO3P/c1-5-2-3-6(8)7(4-5)12(9,10)11/h2-4H,8H2,1H3,(H2,9,10,11)
SMILES:Cc1ccc(c(c1)P(=O)(O)O)N
Sort by
Found 4 products.