CAS 6968-56-5

methyl 3-(5-nitro-1H-indol-3-yl)propanoate

Description:

Methyl 3-(5-nitro-1H-indol-3-yl)propanoate, with the CAS number 6968-56-5, is an organic compound characterized by its structure, which includes a methyl ester functional group and an indole moiety substituted with a nitro group. This compound typically appears as a solid or liquid, depending on its purity and specific conditions. It is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to the bioactive properties associated with indole derivatives. The presence of the nitro group can influence its reactivity and biological activity, making it a subject of interest in various chemical research fields. Additionally, the compound's solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Safety data should be consulted for handling and storage, as compounds with nitro groups can sometimes exhibit explosive properties under certain conditions. Overall, methyl 3-(5-nitro-1H-indol-3-yl)propanoate represents a valuable compound in organic synthesis and drug development.

Formula: C₁₂H₁₂N₂O₄

InChI: InChI=1/C12H12N2O4/c1-18-12(15)5-2-8-7-13-11-4-3-9(14(16)17)6-10(8)11/h3-4,6-7,13H,2,5H2,1H3