CAS 69684-69-1
:methyl (2S)-azetidine-2-carboxylate hydrochloride
Description:
Methyl (2S)-azetidine-2-carboxylate hydrochloride is a chemical compound characterized by its azetidine ring structure, which is a four-membered saturated heterocycle containing one nitrogen atom. This compound features a carboxylate functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of the methyl ester group enhances its solubility in organic solvents, making it useful in various chemical reactions. As a hydrochloride salt, it is typically more stable and easier to handle than its free base form. The stereochemistry indicated by the (2S) designation suggests that the compound has specific spatial arrangements of its atoms, which can influence its biological activity and interactions. Methyl (2S)-azetidine-2-carboxylate hydrochloride is often utilized in the synthesis of pharmaceuticals and agrochemicals, owing to its ability to serve as a building block in the formation of more complex molecules. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C5H10ClNO2
InChI:InChI=1/C5H9NO2.ClH/c1-8-5(7)4-2-3-6-4;/h4,6H,2-3H2,1H3;1H/t4-;/m0./s1
SMILES:COC(=O)[C@@H]1CCN1.Cl
Synonyms:- Methyl (2S)-azetidine-2-carboxylate hydrochloride (1:1)
- (S)-Azetidine-2-Carboxylic Acid Methyl Ester Hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(S)-Azetidine-2-carboxylic acid methyl ester, HCl
CAS:Formula:C5H10ClNO2Purity:97%Color and Shape:SolidMolecular weight:151.5914(S)-Methyl 2-azetidinecarboxylate hydrochloride
CAS:(S)-Methyl 2-azetidinecarboxylate hydrochloridePurity:≥95%Molecular weight:151.59g/molMethyl L-azetidine-2-carboxylate hydrochloride
CAS:Formula:C5H10ClNO2Purity:97%Color and Shape:SolidMolecular weight:151.59(S)-Methyl azetidine-2-carboxylate hydrochloride
CAS:Please enquire for more information about (S)-Methyl azetidine-2-carboxylate hydrochloride including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C5H10ClNO2Purity:Min. 95%Molecular weight:151.59 g/mol



