CAS 69695-61-0
:2-Chloro-4-trifluoromethoxyaniline
Description:
2-Chloro-4-trifluoromethoxyaniline is an organic compound characterized by the presence of a chloro group, a trifluoromethoxy group, and an amino group attached to a benzene ring. Its molecular structure features a chlorine atom and a trifluoromethoxy group (-O-CF3) at the para and meta positions, respectively, relative to the amino group (-NH2). This compound is typically a solid at room temperature and is known for its potential applications in pharmaceuticals and agrochemicals due to its unique electronic properties imparted by the trifluoromethoxy group, which can enhance lipophilicity and biological activity. The presence of the chlorine atom also contributes to its reactivity and potential for further chemical modifications. As with many halogenated compounds, it may exhibit specific environmental and health considerations, necessitating careful handling and disposal. Overall, 2-Chloro-4-trifluoromethoxyaniline is a valuable compound in synthetic organic chemistry, particularly in the development of new materials and active pharmaceutical ingredients.
Formula:C7H5ClF3NO
InChI:InChI=1/C7H5ClF3NO/c8-5-3-4(1-2-6(5)12)13-7(9,10)11/h1-3H,12H2
SMILES:c1cc(c(cc1OC(F)(F)F)Cl)N
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Chloro-4-(Trifluoromethoxy)Aniline
CAS:Formula:C7H5ClF3NOPurity:95%Color and Shape:LiquidMolecular weight:211.56892-Chloro-4-(trifluoromethoxy)aniline
CAS:2-Chloro-4-(trifluoromethoxy)anilineFormula:C7H5ClF3NOPurity:≥95%Color and Shape: clear. faint purple liquidMolecular weight:211.57g/mol2-Chloro-4-(trifluoromethoxy)aniline
CAS:<p>2-Chloro-4-(trifluoromethoxy)aniline is a chemical reagent that is used in organic synthesis. It has a variety of uses including as a building block for complex compounds, an intermediate for the synthesis of other chemicals, and a reagent for the production of pharmaceuticals. 2-Chloro-4-(trifluoromethoxy)aniline is also useful in research to study the mechanism of certain reactions. The high quality and versatility of this compound make it a speciality chemical with many applications.</p>Formula:C7H5ClF3NOMolecular weight:211.57 g/mol2-Chloro-4-(trifluoromethoxy)aniline
CAS:Formula:C7H5ClF3NOPurity:95%Color and Shape:LiquidMolecular weight:211.572-Chloro-4-(trifluoromethoxy)aniline
CAS:Formula:C7H5ClF3NOPurity:>97.0%(GC)(T)Color and Shape:Colorless to Light yellow to Light orange clear liquidMolecular weight:211.57




