CAS 69704-15-0

(2E)-3-(4-hydroxyphenyl)-1-(4-methoxyphenyl)prop-2-en-1-one

Description:

The chemical substance known as (2E)-3-(4-hydroxyphenyl)-1-(4-methoxyphenyl)prop-2-en-1-one, with the CAS number 69704-15-0, is a type of chalcone, which is characterized by its structure featuring a conjugated system of double bonds and carbonyl groups. This compound typically exhibits a yellow to orange color and is known for its potential biological activities, including antioxidant, anti-inflammatory, and anticancer properties. The presence of hydroxyl and methoxy groups on the phenyl rings enhances its reactivity and solubility in organic solvents. Chalcones like this one are often studied for their ability to modulate various biochemical pathways, making them of interest in medicinal chemistry. Additionally, they may exhibit fluorescence, which can be useful in various analytical applications. The compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in both laboratory and industrial settings.

Formula: C₁₆H₁₄O₃

InChI: InChI=1/C16H14O3/c1-19-15-9-5-13(6-10-15)16(18)11-4-12-2-7-14(17)8-3-12/h2-11,17H,1H3/b11-4+

Synonyms:

• 2-propen-1-one, 3-(4-hydroxyphenyl)-1-(4-methoxyphenyl)-, (2E)-

3-(4-Hydroxyphenyl)-1-(4-methoxyphenyl)-2-propen-1-one

CAS: 69704-15-0

Formula: C₁₆H₁₄O₃

Purity: 98%

Molecular weight: 254.2806

Ref: IN-DA00FAIG

4-Hydroxy-4'-methoxychalcone

CAS: 69704-15-0

4-Hydroxy-4'-methoxychalcone

Formula: C₁₆H₁₄O₃

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 254.28g/mol

Ref: 54-OR14435

4-Hydroxy-4'-methoxychalcone

CAS: 69704-15-0

4-Hydroxy-4'-methoxychalcone is a naturally occurring chalcone, which is a type of organic compound featuring two aromatic rings connected by a three-carbon α,β-unsaturated carbonyl system. This compound can be sourced from plants in the Fabaceae family, particularly in species known for their rich flavonoid content. The mode of action of 4-Hydroxy-4'-methoxychalcone involves the modulation of various biochemical pathways, as these chalcones often exhibit antioxidant, anti-inflammatory, and antimicrobial activities. Such modes of action are attributed to their capacity to interact with cellular components, interfere with enzyme activities, and disrupt oxidative stress mechanisms.

Formula: C₁₆H₁₄O₃

Color and Shape: Powder

Molecular weight: 254.28 g/mol

Ref: 3D-FH66688