CymitQuimica logo

CAS 69716-04-7

:

2-(6-Hydroxy-1-benzofuran-3-yl) acetic acid

Description:
2-(6-Hydroxy-1-benzofuran-3-yl) acetic acid, with the CAS number 69716-04-7, is an organic compound characterized by its benzofuran structure, which features a fused benzene and furan ring. This compound contains a hydroxyl group (-OH) at the 6-position of the benzofuran ring and an acetic acid functional group (-COOH) attached to the 2-position. The presence of the hydroxyl group contributes to its potential as a phenolic compound, which may exhibit antioxidant properties. The carboxylic acid group enhances its solubility in polar solvents and can participate in various chemical reactions, such as esterification and amidation. This compound may also exhibit biological activity, making it of interest in pharmaceutical research. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of compounds with anti-inflammatory or neuroprotective effects. Overall, 2-(6-Hydroxy-1-benzofuran-3-yl) acetic acid is a compound of interest due to its unique structure and potential therapeutic properties.
Formula:C10H8O4
InChI:InChI=1S/C10H8O4/c11-7-1-2-8-6(3-10(12)13)5-14-9(8)4-7/h1-2,4-5,11H,3H2,(H,12,13)
InChI key:ZEMXZWJZCWCPBM-UHFFFAOYSA-N
SMILES:C1=CC2=C(C=C1O)OC=C2CC(=O)O
Synonyms:
  • 6-Hydroxy-3-benzofuranacetic acid
Found 4 products.