CAS 69716-05-8
:6-Methoxy-3-benzofuranacetic acid
Description:
6-Methoxy-3-benzofuranacetic acid, identified by its CAS number 69716-05-8, is an organic compound characterized by its unique structure that includes a benzofuran moiety and a methoxy group. This compound typically exhibits properties associated with both aromatic and carboxylic acid functionalities, which can influence its solubility, reactivity, and potential biological activity. The presence of the methoxy group may enhance lipophilicity, allowing for better membrane permeability in biological systems. Additionally, the benzofuran structure can contribute to various pharmacological properties, making it of interest in medicinal chemistry. The compound may participate in hydrogen bonding due to the carboxylic acid group, affecting its interactions in solution and with biological targets. Its synthesis and characterization often involve standard organic chemistry techniques, and it may be studied for potential applications in pharmaceuticals or as a biochemical probe. As with many organic compounds, safety data and handling precautions should be considered when working with this substance in a laboratory setting.
Formula:C11H10O4
InChI:InChI=1S/C11H10O4/c1-14-8-2-3-9-7(4-11(12)13)6-15-10(9)5-8/h2-3,5-6H,4H2,1H3,(H,12,13)
InChI key:InChIKey=QCXJFLREQGIACT-UHFFFAOYSA-N
SMILES:C(C(O)=O)C=1C=2C(=CC(OC)=CC2)OC1
Synonyms:- (6-Methoxy-1-benzofuran-3-yl)acetic acid
- 2-(5-Methoxybenzofuran-1-yl)ethanoic acid
- 2-(6-Methoxy-1-Benzofuran-3-Yl)Acetic Acid
- 2-(6-Methoxybenzofuran-3-yl)acetic acid
- 3-Benzofuranacetic Acid, 6-Methoxy-
- 6-Methoxy-3-benzofuranacetic acid
- (6-Methoxybenzofuran-3-yl)acetic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-(6-Methoxybenzofuran-3-yl)acetic acid
CAS:Formula:C11H10O4Purity:97%Color and Shape:SolidMolecular weight:206.1947(6-Methoxybenzo[b]furan-3-yl)acetic acid
CAS:(6-Methoxybenzo[b]furan-3-yl)acetic acidFormula:C11H10O4Purity:97%Color and Shape: pale yellow to pale brown solidMolecular weight:206.19g/mol2-(6-Methoxy-1-benzofuran-3-yl)acetic acid
CAS:<p>2-(6-Methoxy-1-benzofuran-3-yl)acetic acid (MBFAA) is a fluorescent probe that is used to observe the process of DNA transfer. MBFAA has been shown to be a good candidate for use in the study of nucleophilic substitution reactions and other chemical reactions because it has a high degree of stability. It is also useful as a linear regression analysis tool. The spectral properties are characterized by a red shift in the fluorescence emission spectrum and an increase in fluorescence intensity with increasing concentration.</p>Formula:C11H10O4Purity:Min. 95%Molecular weight:206.19 g/mol



