CAS 6972-05-0
:N,N-Dimethylthiourea
Description:
N,N-Dimethylthiourea is an organic compound characterized by its thiourea structure, where two methyl groups are attached to the nitrogen atoms. It is a white crystalline solid that is soluble in water and organic solvents, making it versatile for various applications. The compound has a molecular formula of C4H10N2S and features a thiourea functional group, which contributes to its reactivity and ability to form coordination complexes with metals. N,N-Dimethylthiourea is often used in organic synthesis, particularly in the preparation of pharmaceuticals and agrochemicals. Additionally, it serves as a reagent in analytical chemistry and can act as a stabilizer for certain metal ions. The compound exhibits low toxicity, but like many chemicals, it should be handled with care to avoid potential health risks. Its properties, such as melting point and boiling point, can vary based on purity and environmental conditions, making it essential to refer to specific data sheets for precise information.
Formula:C3H8N2S
InChI:InChI=1S/C3H8N2S/c1-5(2)3(4)6/h1-2H3,(H2,4,6)
InChI key:InChIKey=ZQGWBPQBZHMUFG-UHFFFAOYSA-N
SMILES:C(N(C)C)(N)=S
Synonyms:- 1,1-Dimethylthiourea
- Ai3-17358
- N,N-Dimethylthiourea
- Nsc 67246
- Thiourea, N,N-dimethyl-
- Urea, 1,1-dimethyl-2-thio-
- Thiourea, N,N-dimethyl- (9ci)
- Urea, 1,1-dimethyl-2-thio- (8ci)
- 1,1-dimethyl-2-thiourea
- 1,1-Dimethyl-thiourea
- Einecs 230-204-7
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
N,N-dimethylthiourea
CAS:Purity:95.0%Color and Shape:Solid, PowderMolecular weight:104.16999816894531N,N-Dimethylthiourea
CAS:N,N-Dimethylthiourea (DMT) is a molecule that has been shown to have in vitro cytotoxic activity. It is an organic compound that contains a methylthiourea group and a dimethylamine (DM) side chain. DMT has been shown to be effective as corrosion inhibitor when used as a coating on metal surfaces, such as steel or titanium. The mechanism of action of DMT is not well understood but it has been shown to competitively inhibit the reaction between chloride ions and molecules containing a methylthiourea group. DMT also has the ability to form hydrogen bonds with other molecules, which may contribute to its in vitro cytotoxic activity.Formula:C3H8N2SPurity:Min. 95 Area-%Color and Shape:PowderMolecular weight:104.18 g/mol



