CAS 6972-51-6
:2,5-Dimethylphenethylalcohol
Description:
2,5-Dimethylphenethylalcohol, with the CAS number 6972-51-6, is an organic compound characterized by its aromatic structure and alcohol functional group. It features a phenethyl backbone with two methyl groups positioned at the 2 and 5 positions of the phenyl ring, contributing to its unique properties. This compound is typically a colorless to pale yellow liquid with a pleasant odor, making it of interest in the fragrance and flavor industries. Its solubility in organic solvents and limited solubility in water reflects its hydrophobic nature, which is common for many aromatic alcohols. The presence of the hydroxyl (-OH) group allows for hydrogen bonding, influencing its boiling point and reactivity. 2,5-Dimethylphenethylalcohol may also exhibit biological activity, although specific applications and effects would depend on further research. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance. Overall, its structural characteristics and functional groups make it a compound of interest in various chemical and industrial applications.
Formula:C10H14O
InChI:InChI=1/C10H14O/c1-8-3-4-9(2)10(7-8)5-6-11/h3-4,7,11H,5-6H2,1-2H3
SMILES:Cc1ccc(C)c(CCO)c1
Synonyms:- 2,5-Dimethylphenethyl alcohol
- 2-(2,5-Dimethylphenyl)Ethanol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2,5-Dimethylphenethyl Alcohol
CAS:Formula:C10H14OPurity:98%Color and Shape:LiquidMolecular weight:150.21762-(2,5-Dimethylphenyl)ethanol
CAS:2-(2,5-Dimethylphenyl)ethanolPurity:95%Molecular weight:150.22g/mol2-(2,5-Dimethylphenyl)ethanol
CAS:2-(2,5-Dimethylphenyl)ethanol is a reagent that reacts with an electrophile to form an alkenylated product. It is used in the synthesis of 2-methylbenzaldehyde and other aromatic hydrocarbons. 2-(2,5-Dimethylphenyl)ethanol reacts with an alkyne to form a substituted ethyl group. This reaction is called alkenylation. The active species of this reagent are the electrophilic carbocations generated by its reaction with the alkene.
Formula:C10H14OPurity:Min. 95%Color and Shape:PowderMolecular weight:150.22 g/mol2-(2,5-Dimethylphenyl)ethanol
CAS:Formula:C10H14OPurity:98%Color and Shape:SolidMolecular weight:150.221



