CAS 697235-38-4
:(-)-Silvestrol
Description:
(-)-Silvestrol is a natural compound classified as a flavagline, which is derived from the plant species Aglaia silvestris. It exhibits a complex molecular structure characterized by a fused ring system that contributes to its biological activity. This compound is known for its potent anti-cancer properties, primarily through its ability to inhibit the eIF4A translation initiation factor, thereby disrupting protein synthesis in cancer cells. Additionally, (-)-Silvestrol has demonstrated anti-inflammatory and antiviral activities, making it a subject of interest in pharmacological research. Its solubility is typically moderate, and it is often studied in various solvent systems for biological assays. The compound's stereochemistry is crucial for its activity, as the specific configuration influences its interaction with biological targets. Overall, (-)-Silvestrol represents a promising lead compound in the development of novel therapeutic agents, particularly in oncology and infectious disease treatment.
Formula:C34H38O13
InChI:InChI=1S/C34H38O13/c1-40-20-12-10-19(11-13-20)34-27(18-8-6-5-7-9-18)26(30(38)42-3)29(37)33(34,39)28-23(41-2)14-21(15-24(28)47-34)45-32-31(43-4)44-17-25(46-32)22(36)16-35/h5-15,22,25-27,29,31-32,35-37,39H,16-17H2,1-4H3/t22-,25-,26-,27-,29-,31-,32-,33+,34+/m1/s1
InChI key:InChIKey=GVKXFVCXBFGBCD-QKDMMWSPSA-N
SMILES:O[C@]12[C@]([C@@H]([C@@H](C(OC)=O)[C@H]1O)C3=CC=CC=C3)(OC=4C2=C(OC)C=C(O[C@H]5[C@H](OC)OC[C@]([C@@H](CO)O)(O5)[H])C4)C6=CC=C(OC)C=C6
Synonyms:- (-)-Silvestrol
- Silvestrol
- 1H-Cyclopenta[b]benzofuran-2-carboxylic acid, 6-[[(2S,3R,6R)-6-[(1R)-1,2-dihydroxyethyl]-3-methoxy-1,4-dioxan-2-yl]oxy]-2,3,3a,8b-tetrahydro-1,8b-dihydroxy-8-methoxy-3a-(4-methoxyphenyl)-3-phenyl-, methyl ester, (1R,2R,3S,3aR,8bS)-
- (1R,2R,3S,3aR,8bS)-6-[[(2S,3R,6R)-6-[(1R)-1,2-Dihydroxyethyl]-3-methoxy-1,4-dioxan-2-yl]oxy]-2,3,3a,8b-tetrahydro-1,8b-dihydroxy-8-methoxy-3a-(4-methoxyphenyl)-3-phenyl-1H-cyclopenta[b]benzofuran-2-carboxylic acid methyl ester
- 1H-Cyclopenta[b]benzofuran-2-carboxylic acid, 6-[[(2S,3R,6R)-6-[(1R)-1,2-dihydroxyethyl]-3-Methoxy-1,4-dioxan-2-yl]o xy]-2,3,3a,8b-tetrahydro-1,8b-dihydroxy-8-Methoxy-3a-(4-Methoxypheny l)-3-phenyl-, Methyl ester, (1R,2R,3S,3aR,8bS)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(1R,2R,3S,3aR,8bS)-6-[[(2S,3R,6R)-6-[(1R)-1,2-Dihydroxyethyl]-3-methoxy-1,4-dioxan-2-yl]oxy]-2,3,3a,8b-tetrahydro-1,8b-dihydroxy-8-methoxy-3a-(4-methoxyphenyl)-3-phenyl-1H-cyclopenta[b]benzofuran-2-carboxylic acid methyl ester
CAS:Formula:C34H38O13Purity:98.11%Color and Shape:SolidMolecular weight:654.6577Silvestrol
CAS:Silvestrol is a natural product with broad-spectrum antiviral. Furthermore, Silvestrol is an anti-cancer compound that is a potent and selective inhibitor of cyclin-dependent kinases, for example, eIF4A. It inhibits the proliferation of cancer cells by blocking their energy metabolism, inhibiting the production of ATP and glutathione (GSH). Silvestrol has been shown to have minimal toxicity in animal studies and can be used as an antitumor agent. It inhibits the Mcl-1 protein, which is a regulator of apoptosis, leading to tumor cell death. Silvestrol also has been shown to induce cell cycle arrest at G2/M phase in human tumor cells without affecting normal cells. The cyclin D2 gene, which is overexpressed in many cancers, may be a target for silvestrol treatment.Formula:C34H38O13Purity:Min. 95%Molecular weight:654.66 g/molSilvestrol
CAS:Silvestrol is a eukaryotic translation initiation factor 4A inhibitor. Silvestrol causes autophagy and caspase-mediated apoptosis.Formula:C34H38O13Purity:98%Color and Shape:SolidMolecular weight:654.66



