
CAS 697245-65-1
:Ethyl 3-(3-methoxyphenyl)-1,2,4-oxadiazole-5-carboxylate
Description:
Ethyl 3-(3-methoxyphenyl)-1,2,4-oxadiazole-5-carboxylate is a chemical compound characterized by its oxadiazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms and three carbon atoms. This compound features an ethyl ester functional group, contributing to its solubility and reactivity. The presence of the 3-methoxyphenyl substituent enhances its potential for biological activity, as methoxy groups can influence the compound's electronic properties and steric effects. Typically, compounds of this nature may exhibit interesting pharmacological properties, making them subjects of research in medicinal chemistry. The oxadiazole moiety is often associated with various biological activities, including antimicrobial and anti-inflammatory effects. Additionally, the compound's structure suggests potential applications in organic synthesis and material science, particularly in the development of novel pharmaceuticals or agrochemicals. As with many organic compounds, its physical properties such as melting point, boiling point, and solubility would depend on the specific conditions and purity of the sample.
Formula:C12H12N2O4
InChI:InChI=1S/C12H12N2O4/c1-3-17-12(15)11-13-10(14-18-11)8-5-4-6-9(7-8)16-2/h4-7H,3H2,1-2H3
InChI key:InChIKey=VTARGSGOKRLXEK-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=NC(=NO1)C2=CC(OC)=CC=C2
Synonyms:- Ethyl 3-(3-methoxyphenyl)-1,2,4-oxadiazole-5-carboxylate
- 1,2,4-Oxadiazole-5-carboxylic acid, 3-(3-methoxyphenyl)-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.