CymitQuimica logo

CAS 697245-66-2

:

Ethyl 3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazole-5-carboxylate

Description:
Ethyl 3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazole-5-carboxylate is a chemical compound characterized by its oxadiazole core, which is a five-membered heterocyclic ring containing two nitrogen atoms. This compound features an ethyl ester functional group, contributing to its solubility and reactivity. The presence of the 3,4-dimethoxyphenyl substituent enhances its potential for biological activity, as methoxy groups can influence the compound's electronic properties and steric effects. Typically, compounds like this may exhibit properties such as fluorescence or photostability, making them of interest in fields like medicinal chemistry or materials science. The oxadiazole moiety is often associated with various pharmacological activities, including antimicrobial and anti-inflammatory effects. Additionally, the compound's structure suggests potential for further derivatization, which could lead to the development of new therapeutic agents. As with many organic compounds, its stability, reactivity, and interactions with biological systems would depend on specific environmental conditions and the presence of other chemical entities.
Formula:C13H14N2O5
InChI:InChI=1S/C13H14N2O5/c1-4-19-13(16)12-14-11(15-20-12)8-5-6-9(17-2)10(7-8)18-3/h5-7H,4H2,1-3H3
InChI key:InChIKey=UAOQPEANZVBDPV-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=NC(=NO1)C2=CC(OC)=C(OC)C=C2
Synonyms:
  • 1,2,4-Oxadiazole-5-carboxylic acid, 3-(3,4-dimethoxyphenyl)-, ethyl ester
  • Ethyl 3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazole-5-carboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.