CAS 69729-06-2
:phe-leu-glu-glu-leu
Description:
The chemical substance known as "phe-leu-glu-glu-leu," with the CAS number 69729-06-2, is a peptide composed of five amino acids: phenylalanine (Phe), leucine (Leu), and glutamic acid (Glu). This peptide exhibits characteristics typical of small peptides, including a relatively low molecular weight and the ability to form specific secondary structures, such as alpha-helices or beta-sheets, depending on the surrounding environment and conditions. Peptides like this one can play significant roles in biological processes, including acting as signaling molecules or influencing metabolic pathways. The presence of hydrophobic amino acids, such as leucine and phenylalanine, suggests that the peptide may have hydrophobic interactions, which can affect its solubility and interaction with biological membranes. Additionally, the glutamic acid residues can contribute to the peptide's overall charge and potential interactions with other biomolecules. Overall, the properties of this peptide can be influenced by its sequence, structure, and the specific conditions under which it is studied.
Formula:C31H47N5O10
InChI:InChI=1/C31H47N5O10/c1-17(2)14-23(35-27(41)20(32)16-19-8-6-5-7-9-19)30(44)34-21(10-12-25(37)38)28(42)33-22(11-13-26(39)40)29(43)36-24(31(45)46)15-18(3)4/h5-9,17-18,20-24H,10-16,32H2,1-4H3,(H,33,42)(H,34,44)(H,35,41)(H,36,43)(H,37,38)(H,39,40)(H,45,46)
SMILES:CC(C)CC(C(=NC(CCC(=O)O)C(=NC(CCC(=O)O)C(=NC(CC(C)C)C(=O)O)O)O)O)N=C(C(Cc1ccccc1)N)O
Synonyms:- H-Phe-Leu-Glu-Glu-Leu-OH
- Phenylalanylleucyl-Alpha-Glutamyl-Alpha-Glutamylleucine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
H-Phe-Leu-Glu-Glu-Leu-OH
CAS:<p>H-Phe-Leu-Glu-Glu-Leu-OH is a synthetic vitamin B6 derivative that has been shown to be effective in treating infectious diseases. It inhibits the synthesis of proteins by inhibiting the carboxylase enzyme, which is involved in the reaction mechanism of amino acid metabolism. This drug also has a redox potential that is higher than that of other drugs and can react with coumarin derivatives to form quinones, which can inhibit protein synthesis. H-Phe-Leu-Glu-Glu-Leu-OH has been shown to be more effective than vitamin B6 in preventing stachyose accumulation and increasing body mass index. The drug also has an epoxidase activity that can lead to an increased production of reactive oxygen species, which may have antioxidant properties. H-Phe-Leu-Glu-Glu-Leu OH also contains a signal peptide and decarboxylated form</p>Formula:C31H47N5O10Purity:Min. 95%Molecular weight:649.73 g/molH-Phe-Leu-Glu-Glu-Leu-OH
CAS:<p>FLEEL, substrate of vitamin K-dependent carboxylase.</p>Formula:C31H47N5O10Purity:> 98%Molecular weight:649.74

