CAS 6973-51-9

4-nitro-1,3-benzothiazol-2-amine

Description:

4-Nitro-1,3-benzothiazol-2-amine is an organic compound characterized by its benzothiazole structure, which consists of a benzene ring fused to a thiazole ring. This compound features a nitro group (-NO2) and an amino group (-NH2) attached to the benzothiazole framework, contributing to its chemical reactivity and potential applications. It is typically a solid at room temperature and may exhibit a yellow to brown color due to the presence of the nitro group. The compound is known for its potential use in various fields, including pharmaceuticals, agrochemicals, and as a dye intermediate. Its reactivity can be attributed to the electron-withdrawing nature of the nitro group, which can influence its behavior in chemical reactions, such as nucleophilic substitutions. Additionally, the presence of the amino group allows for further functionalization, making it a versatile building block in organic synthesis. Safety data should be consulted, as compounds containing nitro groups can pose health risks and environmental concerns.

Formula: C₇H₅N₃O₂S

InChI: InChI=1/C7H5N3O2S/c8-7-9-6-4(10(11)12)2-1-3-5(6)13-7/h1-3H,(H2,8,9)

SMILES: c1cc(c2c(c1)sc(=N)[nH]2)N(=O)=O

Synonyms:

• 2-Benzothiazolamine, 4-Nitro-

4-Nitrobenzo[d]thiazol-2-amine

CAS: 6973-51-9

Formula: C₇H₅N₃O₂S

Purity: 98%

Color and Shape: Solid

Molecular weight: 195.1985

Ref: IN-DA003LV8

4-Nitrobenzo[d]thiazol-2-amine

CAS: 6973-51-9

4-Nitrobenzo[d]thiazol-2-amine

Purity: 97%

Molecular weight: 195.20g/mol

Ref: 54-OR76754

4-Nitrobenzo[d]thiazol-2-amine

CAS: 6973-51-9

Formula: C₇H₅N₃O₂S

Purity: 97%

Color and Shape: Solid

Molecular weight: 195.2

Ref: 10-F091546