CAS 6973-52-0

2-amino-6-oxo-3,6-dihydropyrimidine-4-carboxylic acid

Description:

2-Amino-6-oxo-3,6-dihydropyrimidine-4-carboxylic acid, also known by its CAS number 6973-52-0, is a heterocyclic organic compound that features a pyrimidine ring, which is a six-membered aromatic ring containing two nitrogen atoms. This compound is characterized by the presence of an amino group (-NH2), a carboxylic acid group (-COOH), and a keto group (=O) on the pyrimidine structure, contributing to its reactivity and potential biological activity. It typically appears as a crystalline solid and is soluble in polar solvents due to its functional groups. The compound is of interest in medicinal chemistry and biochemistry, as it may serve as a building block for the synthesis of various pharmaceuticals or as an intermediate in the production of nucleobases. Its structural features suggest potential applications in the development of antimicrobial or antiviral agents, although specific biological activities would require further investigation. Overall, its unique chemical structure and functional groups make it a compound of interest in various chemical and biological research fields.

Formula: C₅H₅N₃O₃

InChI: InChI=1/C5H5N3O3/c6-5-7-2(4(10)11)1-3(9)8-5/h1H,(H,10,11)(H3,6,7,8,9)

SMILES: c1c(C(=O)O)[nH]c(=N)nc1O

Synonyms:

• 2-Amino-6-hydroxypyrimidine-4-carboxylic acid
• 4-Pyrimidinecarboxylic Acid, 2-Amino-6-Hydroxy-
• 2-amino-4-oxo-1H-pyrimidine-6-carboxylicaci
• 4-Pyrimidinecarboxylic acid, 2-amino-1,6-dihydro-6-oxo-
• 2-Amino-1,6-dihydro-6-oxo-4-pyrimidinecarboxylic acid
• 4-Pyrimidinecarboxylic acid, 2-amino-1,6-dihydro-6-oxo- (9CI)
• 2-Amino-6(1H)-oxopyrimidine-4-carboxylic acid
• 2-Aminoorotic acid