CAS 6973-62-2

1,6-di-O-acetyl-2,5-anhydro-3,4-dideoxyhexitol

Description:

1,6-Di-O-acetyl-2,5-anhydro-3,4-dideoxyhexitol is a chemical compound characterized by its unique structural features, which include an anhydro sugar framework and acetyl functional groups. This compound is derived from a hexitol, specifically a dideoxy variant, indicating the absence of hydroxyl groups at specific positions on the sugar ring. The presence of two acetyl groups suggests that it has been modified to enhance its stability and solubility, making it potentially useful in various chemical applications, including organic synthesis and as an intermediate in the production of more complex molecules. The anhydro structure contributes to its rigidity and may influence its reactivity and interaction with other chemical species. Additionally, the compound's CAS number, 6973-62-2, allows for easy identification and reference in chemical databases. Overall, 1,6-di-O-acetyl-2,5-anhydro-3,4-dideoxyhexitol is notable for its structural complexity and potential utility in synthetic chemistry.

Formula: C₁₀H₁₆O₅

InChI: InChI=1/C10H16O5/c1-7(11)13-5-9-3-4-10(15-9)6-14-8(2)12/h9-10H,3-6H2,1-2H3

SMILES: CC(=O)OCC1CCC(COC(=O)C)O1

2,5-Bishydroxymethyl Tetrahydrofuran Diacetate

Controlled Product

CAS: 6973-62-2

Formula: C₁₀H₁₆O₅

Color and Shape: Neat

Molecular weight: 216.23

Ref: TR-B446378