CymitQuimica logo

CAS 697300-73-5

:

3-Bromo-5-iodo-2-pyridinamine

Description:
3-Bromo-5-iodo-2-pyridinamine is a heterocyclic organic compound characterized by the presence of a pyridine ring substituted with both bromine and iodine atoms, as well as an amino group. The molecular structure features a six-membered aromatic ring containing nitrogen, which contributes to its basicity and potential reactivity. This compound is typically used in organic synthesis and medicinal chemistry, where halogenated pyridines can serve as intermediates for the development of pharmaceuticals or agrochemicals. The presence of both bromine and iodine introduces unique reactivity patterns, allowing for various substitution reactions. Additionally, the amino group can participate in hydrogen bonding, influencing the compound's solubility and interaction with biological targets. As with many halogenated compounds, 3-Bromo-5-iodo-2-pyridinamine may exhibit specific physical properties such as melting and boiling points, which are influenced by its molecular weight and the nature of its substituents. Safety and handling precautions are essential due to the potential toxicity associated with halogenated organic compounds.
Formula:C5H4BrIN2
InChI:InChI=1S/C5H4BrIN2/c6-4-1-3(7)2-9-5(4)8/h1-2H,(H2,8,9)
InChI key:InChIKey=OYZOHRSCEASBER-UHFFFAOYSA-N
SMILES:BrC1=C(N)N=CC(I)=C1
Synonyms:
  • 2-Pyridinamine, 3-bromo-5-iodo-
  • 3-Bromo-5-Iodo-2-Pyridinamine
  • 3-Bromo-5-Iodopyridin-2-Amine
  • 3-Bromo-5-iodo-2-aminopyridine
  • 3-Bromo-5-iodo-pyridin-2-ylamine
  • Ab01358
Found 4 products.