CAS 6974-25-0
:2,4-diamino-5,6,7,8-tetrahydroquinazoline-6-carboxylic acid
Description:
2,4-Diamino-5,6,7,8-tetrahydroquinazoline-6-carboxylic acid, with the CAS number 6974-25-0, is a heterocyclic organic compound characterized by its quinazoline structure, which features a fused bicyclic system. This compound contains two amino groups at the 2 and 4 positions and a carboxylic acid group at the 6 position, contributing to its potential as a bioactive molecule. It is typically a white to off-white solid and is soluble in polar solvents, which is common for compounds containing carboxylic acid functionalities. The presence of amino groups suggests that it may participate in various chemical reactions, including those involving nucleophilic substitution or condensation. This compound has garnered interest in medicinal chemistry due to its potential pharmacological properties, including antimicrobial and anticancer activities. Its structural features allow for interactions with biological targets, making it a candidate for further research in drug development. However, specific applications and biological activities would require additional investigation and validation through experimental studies.
Formula:C9H12N4O2
InChI:InChI=1/C9H12N4O2/c10-7-5-3-4(8(14)15)1-2-6(5)12-9(11)13-7/h4H,1-3H2,(H,14,15)(H4,10,11,12,13)
SMILES:C1Cc2c(CC1C(=O)O)c(=N)[nH]c(=N)[nH]2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2,4-Diamino-5,6,7,8-tetrahydro-6-quinazolinecarboxylic Acid
CAS:Controlled ProductFormula:C9H12N4O2Color and Shape:NeatMolecular weight:208.217
