CAS 6974-29-4
:N-(trifluoroacetyl)ethanolamine
Description:
N-(Trifluoroacetyl)ethanolamine is an organic compound characterized by the presence of both an amine and a carbonyl functional group, specifically a trifluoroacetyl group. This compound features a hydroxyl group (-OH) and an amine group (-NH2) attached to a two-carbon ethanol backbone, making it a derivative of ethanolamine. The trifluoroacetyl moiety contributes to its unique properties, including increased lipophilicity and potential reactivity in various chemical reactions. The presence of three fluorine atoms enhances the compound's electronegativity and can influence its interaction with biological systems, potentially affecting its solubility and stability. N-(Trifluoroacetyl)ethanolamine may be utilized in synthetic organic chemistry, particularly in the development of pharmaceuticals or agrochemicals, due to its ability to participate in acylation reactions. Safety data indicates that, like many fluorinated compounds, it should be handled with care, as it may pose health risks upon exposure. Overall, this compound exemplifies the intersection of organic chemistry and functional group manipulation, showcasing the versatility of amine derivatives in chemical synthesis.
Formula:C4H6F3NO2
InChI:InChI=1/C4H6F3NO2/c5-4(6,7)3(10)8-1-2-9/h9H,1-2H2,(H,8,10)
SMILES:C(CO)N=C(C(F)(F)F)O
Synonyms:- N-(2-Hydroxyethyl)trifluoroacetamide
- 2,2,2-trifluoro-N-(2-hydroxyethyl)acetamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
N-(2-HYDROXYETHYL)-2,2,2-TRIFLUOROACETAMIDE
CAS:Formula:C4H6F3NO2Purity:98%Color and Shape:SolidMolecular weight:157.09112,2,2-Trifluoro-N-(2-hydroxyethyl)acetamide
CAS:2,2,2-Trifluoro-N-(2-hydroxyethyl)acetamidePurity:97%Molecular weight:157.09g/mol2,2,2-Trifluoro-N-(2-hydroxyethyl)acetamide
CAS:2,2,2-Trifluoro-N-(2-hydroxyethyl)-acetamide is a synthetic compound that has been used as a conjugate for radioactively labeled trifluoroacetic acid. It is used to study the uptake of this acid by the pancreas and the liver. This compound has also been postulated to be reactive with primary amino groups in proteins and phosphatidylethanolamine (PE) in cell membranes. 2,2,2-Trifluoro-N-(2-hydroxyethyl)-acetamide is hydrophilic and can act as a chloride ionophore. This makes it useful for the transport of ions across membranes.
Formula:C4H6F3NO2Purity:Min. 95%Color and Shape:PowderMolecular weight:157.09 g/mol



