CAS 6974-56-7
:N1-(2,4-dichlorophenyl)-2-chloroacetamide
Description:
N1-(2,4-dichlorophenyl)-2-chloroacetamide, with the CAS number 6974-56-7, is a chemical compound that belongs to the class of amides. It is characterized by the presence of a dichlorophenyl group, which contributes to its chemical stability and potential biological activity. The compound features a chloroacetamide functional group, which is known for its reactivity and ability to participate in various chemical reactions. Typically, such compounds may exhibit herbicidal or fungicidal properties, making them of interest in agricultural applications. The presence of chlorine atoms in its structure often enhances lipophilicity, influencing its solubility and interaction with biological systems. In terms of physical properties, it may be a solid at room temperature, with specific melting and boiling points that depend on its molecular interactions. Safety data should be consulted for handling and exposure guidelines, as compounds with similar structures can exhibit toxicity or environmental persistence. Overall, N1-(2,4-dichlorophenyl)-2-chloroacetamide is a compound of interest in both synthetic chemistry and applied sciences.
Formula:C8H6Cl3NO
InChI:InChI=1/C8H6Cl3NO/c9-4-8(13)12-7-2-1-5(10)3-6(7)11/h1-3H,4H2,(H,12,13)
SMILES:c1cc(c(cc1Cl)Cl)N=C(CCl)O
Synonyms:- 2-chloro-N-(2,4-dichlorophenyl)acetamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
N-(Chloroacetyl)-2,4-dichloroaniline
CAS:N-(Chloroacetyl)-2,4-dichloroanilinePurity:95%Molecular weight:238.50g/mol2-Chloro-N-(2,4-dichlorophenyl)acetamide
CAS:<p>2-Chloro-N-(2,4-dichlorophenyl)acetamide is a white crystalline powder with a molecular weight of 188.7. It has the chemical formula C8H8Cl2NO2 and a molar mass of 176.6 grams per mole. The compound belongs to the class of substituted acetamides that have a conformation of chains and crystals with an asymmetric carbon atom in the molecule. 2-Chloro-N-(2,4-dichlorophenyl)acetamide has been shown to have hydrogen bonding with other molecules in its environment. This product is used as an herbicide for weed control on agricultural crops and turf grasses.</p>Formula:C8H6Cl3NOPurity:Min. 95%Molecular weight:238.5 g/mol



