CAS 6974-61-4
:1-(1,3-benzodioxol-5-yl)propan-2-ol
Description:
1-(1,3-benzodioxol-5-yl)propan-2-ol, also known by its CAS number 6974-61-4, is an organic compound characterized by its structure, which includes a propanol backbone substituted with a 1,3-benzodioxole moiety. This compound typically exhibits properties associated with alcohols, such as being a colorless to pale yellow liquid with a characteristic odor. It is soluble in organic solvents and may have limited solubility in water due to the hydrophobic nature of the benzodioxole ring. The presence of the hydroxyl (-OH) group contributes to its reactivity, allowing it to participate in various chemical reactions, including esterification and oxidation. Additionally, compounds with similar structures are often studied for their potential biological activities, including antioxidant and anti-inflammatory properties. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C10H12O3
InChI:InChI=1/C10H12O3/c1-7(11)4-8-2-3-9-10(5-8)13-6-12-9/h2-3,5,7,11H,4,6H2,1H3
SMILES:CC(Cc1ccc2c(c1)OCO2)O
Synonyms:- 1-(1,3-Benzodioxol-5-yl)-2-propanol
- 1-(3,4-Methylenedioxyphenyl)-2-propanol
- 1,3-Benzodioxole-5-Ethanol, Alpha-Methyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1,3-Benzodioxole-5-ethanol, a-methyl-
CAS:Formula:C10H12O3Purity:98%Color and Shape:LiquidMolecular weight:180.20051-(2H-1,3-benzodioxol-5-yl)propan-2-ol
CAS:Controlled ProductApplications 1-(2H-1,3-benzodioxol-5-yl)propan-2-ol (cas# 6974-61-4) is a useful research chemical.
Formula:C10H12O3Color and Shape:NeatMolecular weight:180.21-(1,3-Dioxaindan-5-yl)propan-2-ol
CAS:Controlled Product1-(1,3-Dioxaindan-5-yl)propan-2-ol is an intermediate in the synthesis of the drug 1-(1,3-dioxan-5-yl)propan-2-ol. It is extracted from the reaction mixture by removing the organic solvent and drying with anhydrous magnesium sulfate. The product can be used as a starting material for synthesizing 1-(1,3-dioxan-5-yl)propan-2-ol. It has been shown to have good antiinflammatory effects in vivo.Formula:C10H12O3Purity:Min. 95%Molecular weight:180.2 g/mol



