CAS 6974-77-2
:1-Bromo-3-chloro-2-methylpropane
Description:
1-Bromo-3-chloro-2-methylpropane, with the CAS number 6974-77-2, is an organic compound that belongs to the class of haloalkanes. It features a branched alkane structure, characterized by the presence of both bromine and chlorine halogen substituents on the carbon chain. This compound typically exhibits a colorless to pale yellow liquid appearance and has a relatively low boiling point, which is common for haloalkanes due to their molecular weight and structure. The presence of halogens contributes to its reactivity, making it useful in various chemical synthesis processes, including nucleophilic substitution reactions. Additionally, 1-bromo-3-chloro-2-methylpropane is considered to have moderate toxicity, necessitating careful handling and appropriate safety measures during use. Its applications may extend to the fields of organic synthesis, pharmaceuticals, and agrochemicals, where it can serve as an intermediate or reagent. As with many halogenated compounds, environmental considerations regarding its persistence and potential bioaccumulation are important in assessing its overall impact.
Formula:C4H8BrCl
InChI:InChI=1S/C4H8BrCl/c1-4(2-5)3-6/h4H,2-3H2,1H3
InChI key:InChIKey=ZKDOQFPDSUOLGF-UHFFFAOYSA-N
SMILES:C(CBr)(CCl)C
Synonyms:- (2S)-1-bromo-3-chloro-2-methylpropane
- 1-Chloro-2-Methyl-3-Bromopropane
- 1-Chloro-3-bromo-2-methylpropane
- 2-Methyl-1-bromo-3-chloropropane
- 2-Methyl-1-chloro-3-bromopropane
- 3-Bromo-2-methyl-1-chloropropane
- NSC 21695
- Propane, 1-bromo-3-chloro-2-methyl-
- 1-Bromo-3-chloro-2-methylpropane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
1-Bromo-3-chloro-2-methylpropane
CAS:Formula:C4H8BrClPurity:97%Color and Shape:LiquidMolecular weight:171.46331-Bromo-3-chloro-2-methylpropane
CAS:1-Bromo-3-chloro-2-methylpropanePurity:98%Molecular weight:171.46g/mol1-Bromo-3-chloro-2-methylpropane
CAS:Formula:C4H8BrClPurity:>98.0%(GC)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:171.461-Bromo-3-chloro-2-methylpropane
CAS:Applications 1-Bromo-3-chloro-2-methylpropane is used as a reagent in the synthesis of N-substituted oxazolo[5,4-b]pyridin-2(1H)-ones as a new class of non-opiate antinociceptive agents.
References Viaud, M., et al.: J. Med. Chem., 38, 1278 (1995)Formula:C4H8BrClColor and Shape:ColourlessMolecular weight:171.461-Bromo-3-chloro-2-methylpropane
CAS:Formula:C4H8BrClPurity:95.0%Color and Shape:Clear colourless to almost colourless liquidMolecular weight:171.461-Bromo-3-chloro-2-methylpropane
CAS:1-Bromo-3-chloro-2-methylpropane is a halocarbon that is used as a reagent in organic synthesis. It has been used in the synthesis of pharmaceuticals such as acetaminophen and ibuprofen, as well as other compounds. It is also used to study the properties of halocarbons, including thermal conductivity and isomerism. The reactions are typically carried out using a Grignard reagent, which reacts with the bromide ion to form an organobromine compound. The reaction can be done experimentally or in the laboratory.Formula:C4H8BrClPurity:Min. 95%Molecular weight:171.46 g/mol





