CymitQuimica logo

CAS 69745-21-7

:

(1Z)-1,6-dihydroxy-1-(4-methylphenyl)hex-1-en-3-one

Description:
(1Z)-1,6-dihydroxy-1-(4-methylphenyl)hex-1-en-3-one, with the CAS number 69745-21-7, is an organic compound characterized by its unique structural features, including a hexene backbone with hydroxyl groups and a phenyl substituent. This compound exhibits both hydrophilic and hydrophobic properties due to the presence of hydroxyl groups and an aromatic ring, respectively. It is likely to participate in hydrogen bonding, which can influence its solubility in various solvents. The presence of the double bond in the hexene structure suggests that it may undergo reactions typical of alkenes, such as electrophilic addition or polymerization. Additionally, the compound's functional groups may contribute to its reactivity and potential applications in fields such as pharmaceuticals or materials science. Its specific stereochemistry, indicated by the (1Z) configuration, suggests that it has a defined spatial arrangement, which can affect its biological activity and interactions with other molecules. Overall, this compound's characteristics make it a subject of interest for further research and application in various chemical contexts.
Formula:C13H16O3
InChI:InChI=1/C13H16O3/c1-10-4-6-11(7-5-10)13(16)9-12(15)3-2-8-14/h4-7,9,14,16H,2-3,8H2,1H3/b13-9-
SMILES:Cc1ccc(cc1)/C(=C/C(=O)CCCO)/O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.